Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Azoramide is a small-molecule modulator of the unfolded protein response with antidiabetic activity. |
|---|
| Catalog Num | A16075 |
|---|---|
| Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 |
| CAS Number | 932986-18-0 |
| SMILES | CCCC(=O)NCCC1=CSC(=N1)C2=CC=C(C=C2)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (194.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 60 mg/mL (194.27 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.38 mL | 161.9 mL | 323.8 mL |
| 0.5 mM | 6.48 mL | 32.38 mL | 64.76 mL |
| 1 mM | 3.24 mL | 16.19 mL | 32.38 mL |
| 5 mM | 0.65 mL | 3.24 mL | 6.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
