Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EAI045 ia a potent and selective EGFR inhbitor. EAI045 targets selected drug-resistant EGFR mutants but spares the wild-type receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16193 |
|---|---|
| Formula | C19H14FN3O3S |
| Molecular Weight | 383.4 |
| CAS Number | 1942114-09-1 |
| SMILES | FC1=CC=C(C(C(N2CC(C=CC=C3)=C3C2=O)C(NC4=NC=CS4)=O)=C1)O |
| Synonyms | EAI-045, EAI 045 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (195.61 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.08 mL | 130.41 mL | 260.82 mL |
| 0.5 mM | 5.22 mL | 26.08 mL | 52.16 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.08 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
