Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Epibrassinolide is a biologically active compound of the brassinosteroids, steroid-derived plant growth regulator family; was shown as a potential apoptotic inducer in various cancer cells without affecting the non-tumor cell growth. |
|---|
| Catalog Num | A16322 |
|---|---|
| Formula | C28H48O6 |
| Molecular Weight | 480.68 |
| CAS Number | 78821-43-9 |
| SMILES | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2COC(=O)[C@@H]4[C@@]3(C[C@H]([C@H](C4)O)O)C)C)[C@H]([C@@H]([C@H](C)C(C)C)O)O |
| Synonyms | 24-Epibrassinolide, B1105, BP55 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (183.07 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (31.2 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.8 mL | 104.02 mL | 208.04 mL |
| 0.5 mM | 4.16 mL | 20.8 mL | 41.61 mL |
| 1 mM | 2.08 mL | 10.4 mL | 20.8 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
