Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK 5959 is a potent, selective and cell permeable BRPF1 bromodomain inhibitor with IC50 ~ 80 nM. Exhibits >100-fold selectivity for BRPF1 over a panel of 35 other bromodomains, including BRPF2/3 and BET family bromodomains. |
|---|
| Catalog Num | A16092 |
|---|---|
| Formula | C22H26N4O3 |
| Molecular Weight | 394.48 |
| CAS Number | 901245-65-6 |
| SMILES | O=C(NC1=C(N2CCCCC2)C=C(N3C)C(N(C)C3=O)=C1)C4=CC=CC=C4OC |
| Synonyms | GSK-5959, GSK5959 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (12.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.35 mL | 126.75 mL | 253.5 mL |
| 0.5 mM | 5.07 mL | 25.35 mL | 50.7 mL |
| 1 mM | 2.53 mL | 12.67 mL | 25.35 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
