Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK591 is a potent selective inhibitor of the arginine methyltransferase PRMT5 with IC50 of 11 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14374 |
|---|---|
| Formula | C22H28N4O2 |
| Molecular Weight | 380.48 |
| CAS Number | 1616391-87-7 |
| SMILES | O=C(NC[C@H](O)CN1CCC(C=CC=C2)=C2C1)C3=CC(NC4CCC4)=NC=C3 |
| Synonyms | EPZ015866,GSK3203591 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (197.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 75 mg/mL (197.11 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.28 mL | 131.41 mL | 262.83 mL |
| 0.5 mM | 5.26 mL | 26.28 mL | 52.57 mL |
| 1 mM | 2.63 mL | 13.14 mL | 26.28 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
