Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nifuroxazide is an inhibitor of STAT activation and signaling activity, is an oral nitrofuran antibiotic, used to treat colitis and diarrhea in humans and non-humans. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16220 |
|---|---|
| Formula | C12H9N3O5 |
| Molecular Weight | 275.22 |
| CAS Number | 965-52-6 |
| SMILES | C1=CC(=CC=C1C(=O)NN=CC2=CC=C(O2)[N+](=O)[O-])O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (170.77 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.33 mL | 181.67 mL | 363.35 mL |
| 0.5 mM | 7.27 mL | 36.33 mL | 72.67 mL |
| 1 mM | 3.63 mL | 18.17 mL | 36.33 mL |
| 5 mM | 0.73 mL | 3.63 mL | 7.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
