Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PQR309 is an orally bioavailable pan inhibitor of phosphoinositide-3-kinases (PI3K) and inhibitor of the mammalian target of rapamycin (mTOR), with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15992 |
|---|---|
| Formula | C17H20F3N7O |
| Molecular Weight | 411.39 |
| CAS Number | 1225037-39-7 |
| SMILES | NC1=NC=C(C2=NC(N3CCOCC3)=NC(N4CCOCC4)=N2)C(C(F)(F)F)=C1 |
| Synonyms | PQR-309, PQR 309 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (14.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.31 mL | 121.54 mL | 243.08 mL |
| 0.5 mM | 4.86 mL | 24.31 mL | 48.62 mL |
| 1 mM | 2.43 mL | 12.15 mL | 24.31 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
