Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 1-NA-PP1 is a selective inhibitor of v-Src and c-Fyn as well as c-Abl |
|---|
| Catalog Num | A13232 |
|---|---|
| Formula | C19H19N5 |
| Molecular Weight | 317.4 |
| CAS Number | 221243-82-9 |
| SMILES | CC(C)(C)N1C2=C(C(=N1)C3=CC=CC4=CC=CC=C43)C(=NC=N2)N |
| Synonyms | 1-Naphthyl-PP1; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (25.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.51 mL | 157.53 mL | 315.06 mL |
| 0.5 mM | 6.3 mL | 31.51 mL | 63.01 mL |
| 1 mM | 3.15 mL | 15.75 mL | 31.51 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
