Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | 5-Hydroxytryptophan (5-HTP) is a naturally occurring amino acid and chemical precursor as well as a metabolic intermediate in the biosynthesis of the neurotransmitters serotonin and melatonin from tryptophan. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10017 |
|---|---|
| Formula | C11H12N2O3 |
| Molecular Weight | 220.2 |
| CAS Number | 56-69-9 |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N |
| Synonyms | 5-HTP, oxitriptan |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (181.64 mM) | |
| Water | 4 mg/mL (18.16 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.41 mL | 227.07 mL | 454.13 mL |
| 0.5 mM | 9.08 mL | 45.41 mL | 90.83 mL |
| 1 mM | 4.54 mL | 22.71 mL | 45.41 mL |
| 5 mM | 0.91 mL | 4.54 mL | 9.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
