Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Abacavir sulfate is a nucleoside analog reverse transcriptase inhibitor (NRTI); guanosine analog used to treat HIV and AIDS. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11120 |
|---|---|
| Formula | C14H18N6O.H2SO4 |
| Molecular Weight | 384.4 |
| CAS Number | 188062-50-2 |
| SMILES | C1CC1NC2=NC(=NC3=C2N=CN3[C@@H]4C[C@@H](C=C4)CO)N.OS(=O)(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 33 mg/mL (98.4 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.01 mL | 130.07 mL | 260.15 mL |
| 0.5 mM | 5.2 mL | 26.01 mL | 52.03 mL |
| 1 mM | 2.6 mL | 13.01 mL | 26.01 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
