Signaling Pathway
ADX-47273 is a drug used in scientific research which acts as a positive allosteric modulator selective for the metabotropic glutamate receptor subtype mGluR5.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ADX-47273 is a drug used in scientific research which acts as a positive allosteric modulator selective for the metabotropic glutamate receptor subtype mGluR5. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11181 |
|---|---|
| Formula | C20H17F2N3O2 |
| Molecular Weight | 369.36 |
| CAS Number | 851881-60-2 |
| SMILES | C1C[C@@H](CN(C1)C(=O)C2=CC=C(C=C2)F)C3=NC(=NO3)C4=CC=C(C=C4)F |
| Synonyms | ADX47273 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 73 mg/mL (197.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 29 mg/mL (78.51 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.07 mL | 135.37 mL | 270.74 mL |
| 0.5 mM | 5.41 mL | 27.07 mL | 54.15 mL |
| 1 mM | 2.71 mL | 13.54 mL | 27.07 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
