Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Alfuzosin (provided as the hydrochloride salt) is an α1 receptor antagonist used to treat benign prostatic hyperplasia (BPH). It works by relaxing the muscles in the prostate and bladder neck, making it easier to urinate. |
|---|
| Catalog Num | A10052 |
|---|---|
| Formula | C19H27N5O4.HCl |
| Molecular Weight | 425.9 |
| CAS Number | 81403-68-1 |
| SMILES | CN(CCCNC(=O)C1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC.Cl |
| Synonyms | Uroxatral |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 83 mg/mL (194.87 mM) | |
| Water | 83 mg/mL (194.87 mM) | ||
| Ethanol | 83 mg/mL (194.87 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.48 mL | 117.4 mL | 234.8 mL |
| 0.5 mM | 4.7 mL | 23.48 mL | 46.96 mL |
| 1 mM | 2.35 mL | 11.74 mL | 23.48 mL |
| 5 mM | 0.47 mL | 2.35 mL | 4.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
