Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ARRY-380 is an ErbB-2 inhibitor that selectively binds to and inhibits the phosphorylation of ErbB-2, resulting in growth inhibition and death of ErbB-2-expressing tumor cells. |
|---|
| Catalog Num | A11027 |
|---|---|
| Formula | C29H27N7O4S |
| Molecular Weight | 569.9 |
| CAS Number | 937265-83-3 |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=NC3=C2C=C(C=C3)C4=CC=C(O4)CNCCS(=O)(=O)C)OC5=CC6=NC=NN6C=C5 |
| Synonyms | Arry380 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (158 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (5.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.55 mL | 87.73 mL | 175.47 mL |
| 0.5 mM | 3.51 mL | 17.55 mL | 35.09 mL |
| 1 mM | 1.75 mL | 8.77 mL | 17.55 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
