Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | AT13387 is a targeted inhibitor of Hsp90,inhibiting its chaperone function and promoting the degradation of oncogenic signaling proteins involved in tumor cell proliferation and survival. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11062 |
|---|---|
| Formula | C24H31N3O3 |
| Molecular Weight | 409.5 |
| CAS Number | 912999-49-6 |
| SMILES | CC(C)C1=C(C=C(C(=C1)C(=O)N2CC3=C(C2)C=C(C=C3)CN4CCN(CC4)C)O)O |
| Synonyms | AT-13387 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 22 mg/mL (53.72 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O (prepare before use) | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.42 mL | 122.1 mL | 244.2 mL |
| 0.5 mM | 4.88 mL | 24.42 mL | 48.84 mL |
| 1 mM | 2.44 mL | 12.21 mL | 24.42 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
