Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD8330 is a novel, selective, non-ATP competitive MEK 1/2 inhibitor with IC50 of 7 nM. Phase 1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10115 |
|---|---|
| Formula | C16H17FIN3O4 |
| Molecular Weight | 461.2 |
| CAS Number | 869357-68-6 |
| SMILES | CC1=CC(=C(N(C1=O)C)NC2=C(C=C(C=C2)I)F)C(=O)NOCCO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 88 mg/mL (190.79 mM) | |
| Water | Insoluble | ||
| Ethanol | 88 mg/mL (190.79 mM) | ||
| In vivo | 0.5% hydroxyethyl cellulose+0.1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.68 mL | 108.41 mL | 216.83 mL |
| 0.5 mM | 4.34 mL | 21.68 mL | 43.37 mL |
| 1 mM | 2.17 mL | 10.84 mL | 21.68 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
