Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD8931 is an oral, equipotent inhibitor of ErbB1, ErbB2 and ErbB3 receptor signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10116 |
|---|---|
| Formula | C23H25ClFN5O3 |
| Molecular Weight | 473.9 |
| CAS Number | 848942-61-0 |
| SMILES | CNC(=O)CN1CCC(CC1)OC2=C(C=C3C(=C2)C(=NC=N3)NC4=C(C(=CC=C4)Cl)F)OC |
| Synonyms | Momelotinib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 37 mg/mL (78.07 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.1 mL | 105.51 mL | 211.01 mL |
| 0.5 mM | 4.22 mL | 21.1 mL | 42.2 mL |
| 1 mM | 2.11 mL | 10.55 mL | 21.1 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
