Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Betulin is a triterpene with a pentacyclic ring structure and hydroxyl groups in positions C3 and C28. Betulin has protective effects against cadmium induced apoptosis in human hepatoma cell lines. |
|---|
| Catalog Num | A12210 |
|---|---|
| Formula | C30H50O2 |
| Molecular Weight | 442.72 |
| CAS Number | 473-98-3 |
| SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)CO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 22 mg/mL (49.69 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.59 mL | 112.94 mL | 225.88 mL |
| 0.5 mM | 4.52 mL | 22.59 mL | 45.18 mL |
| 1 mM | 2.26 mL | 11.29 mL | 22.59 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
