Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-626529 is a potent HIV-1 attachment inhibitor. BMS-663068 is also the phosphonooxymethyl prodrug of BMS-626529 that targets HIV-1 gp120 and prevents its binding to CD4(+) T cells. |
|---|
| Catalog Num | A14148 |
|---|---|
| Formula | C24H23N7O4 |
| Molecular Weight | 473.48 |
| CAS Number | 701213-36-7 |
| SMILES | CC1=NN(C=N1)C2=NC=C(C3=C2NC=C3C(=O)C(=O)N4CCN(CC4)C(=O)C5=CC=CC=C5)OC |
| Synonyms | BMS-626529,BMS626529 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (194.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.12 mL | 105.6 mL | 211.2 mL |
| 0.5 mM | 4.22 mL | 21.12 mL | 42.24 mL |
| 1 mM | 2.11 mL | 10.56 mL | 21.12 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
