Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | BMS-663068 is an HIV-1 attachment inhibitor in development for the treatment of HIV-1 infection. |
|---|
| Catalog Num | A15025 |
|---|---|
| Formula | C25H26N7O8P |
| Molecular Weight | 583.49 |
| CAS Number | 864953-29-7 |
| SMILES | CC1=NN(C=N1)C2=NC=C(C3=C2N(C=C3C(=O)C(=O)N4CCN(CC4)C(=O)C5=CC=CC=C5)COP(=O)(O)O)OC |
| Synonyms | BMS663068, BMS 663068 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (166.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.14 mL | 85.69 mL | 171.38 mL |
| 0.5 mM | 3.43 mL | 17.14 mL | 34.28 mL |
| 1 mM | 1.71 mL | 8.57 mL | 17.14 mL |
| 5 mM | 0.34 mL | 1.71 mL | 3.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
