Total item
Cart Subtotal
$0.00 Biological Activity
BMY 7378 is a 5-HT1A partial agonist and high affinity α1D adrenoceptor antagonist.
Targets
| Target | Value |
|---|---|
| 5-HT1A | pIC50: 8.3 |
| α1D-adrenoceptor | pki: 8.2 |
| DopamineD2receptor | pIC50: 7.4 |
| α2C-adrenoceptor | pki: 6.54 |
| 5-HT1C | pIC50: 6.4 |
| 5-HT1D | pIC50: 5.9 |
| H1receptor | pIC50: 5.7 |
| 5-HT2 | pIC50: 5.5 |
| H2receptor | pIC50: 5.3 |
| α2-adrenoceptor | pIC50: 5.1 |
| β1-adrenoceptor | pIC50: 5.1 |
| DopamineD1receptor | pIC50: 5 |
| Nicotinicreceptor | pIC50: 4.9 |
| β2-adrenoceptor | pIC50: <5.0 |
| 5-HT3 | pIC50: <5.0 |
| H3receptor | pIC50: <5.0 |
| GABAAreceptor | pIC50: <5.0 |
| GABABreceptor | pIC50: <5.0 |
| MuscarinicM1receptor | pIC50: <5.0 |
| MuscarinicM2receptor | pIC50: <5.0 |
| MuscarinicM3receptor | pIC50: <5.0 |
| NMDAreceptor | pIC50: <5.0 |
| AT1receptor | pIC50: <5.0 |
| AT2receptor | pIC50: <5.0 |
| EndothelinReceptor | pIC50: <5.0 |
| AdenosineA1receptor | pIC50: <5.0 |
| AdenosineA2receptor | pIC50: <5.0 |
| In vitro (25°C) | DMSO | 92 mg/mL (200.68 mM) | |
| Water | 92 mg/mL (200.68 mM) | ||
| Ethanol | 20 mg/mL (43.62 mM) | ||
| In vivo | Saline | 15 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.81 mL | 109.07 mL | 218.14 mL |
| 0.5 mM | 4.36 mL | 21.81 mL | 43.63 mL |
| 1 mM | 2.18 mL | 10.91 mL | 21.81 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.36 mL |
*The above data is based on the productmolecular weight 458.42. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A11208 |
|---|---|
| Actions | Agonist |
| M. Wt | 458.42 |
| Formula | C22H31N3O3.2HCl |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 21102-95-4 |
| Synonyms | BMY7378, BMY-7378 |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCN3C(=O)CC4(CCCC4)CC3=O.Cl.Cl |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy BMY 7378 | BMY 7378 Supplier | purchase BMY 7378 | BMY 7378 cost | BMY 7378 manufacturer | order BMY 7378 | BMY 7378 distributor | buy 21102-95-4| 21102-95-4 Supplier | purchase 21102-95-4 | 21102-95-4 cost | 21102-95-4 manufacturer | order 21102-95-4 | 21102-95-4 distributor
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: [email protected]
Not your Region? View all Distributors
Adooq Quality Guarantee
We promise all products perform as described.