Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Canertinib (CI-1033) is an irreversible tyrosine-kinase inhibitor with activity against EGFR (IC50 0.8 nM), HER-2 (IC50 19 nM) and ErbB-4 (IC50 7 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10211 |
|---|---|
| Formula | C24H25ClFN5O3 |
| Molecular Weight | 485.9 |
| CAS Number | 267243-28-7 |
| SMILES | C=CC(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4 |
| Synonyms | PD-183805 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 2 mg/mL (4.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (16.46 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.58 mL | 102.9 mL | 205.8 mL |
| 0.5 mM | 4.12 mL | 20.58 mL | 41.16 mL |
| 1 mM | 2.06 mL | 10.29 mL | 20.58 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
