Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cilomilast is orally active and acts as a selective Phosphodiesterase-4 inhibitor with antiinflammatory effects that target bronchoconstriction, mucus hypersecretion, and airway remodeling associated with COPD. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10216 |
|---|---|
| Formula | C20H25NO4 |
| Molecular Weight | 343.4 |
| CAS Number | 153259-65-5 |
| SMILES | COC1=C(C=C(C=C1)C2(CCC(CC2)C(=O)O)C#N)OC3CCCC3 |
| Synonyms | Ariflo |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 64 mg/mL (186.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL (136.85 mM) | ||
| In vivo | 5% DMSO+95% Corn oil | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.12 mL | 145.6 mL | 291.21 mL |
| 0.5 mM | 5.82 mL | 29.12 mL | 58.24 mL |
| 1 mM | 2.91 mL | 14.56 mL | 29.12 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
