Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cimetidine is a histamine H2-receptor antagonist that inhibits stomach acid production. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10218 |
|---|---|
| Formula | C10H16N6S |
| Molecular Weight | 252.34 |
| CAS Number | 51481-61-9 |
| SMILES | CC1=C(N=CN1)CSCCNC(=NC)NC#N |
| Synonyms | SKF-92334 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (182.29 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (11.88 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.63 mL | 198.15 mL | 396.29 mL |
| 0.5 mM | 7.93 mL | 39.63 mL | 79.26 mL |
| 1 mM | 3.96 mL | 19.81 mL | 39.63 mL |
| 5 mM | 0.79 mL | 3.96 mL | 7.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
