BIX02188
Catalog No. A10150
BIX02188 is a potent and selective inhibitor of MEK5.
Catalog Num | A10150 |
---|---|
M. Wt | 426.5 |
Formula | C26H26N4O2 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1094614-84-2 |
Synonyms | BIX-02188 |
SMILES | CN(C)CC1=CC(=CC=C1)N/C(=C\2/C3=C(C=C(C=C3)C(=O)N)NC2=O)/C4=CC=CC=C4 |
BIX02188 is a potent and selective inhibitor of MEK5.
Targets
Target | Value |
---|---|
MEK5 | IC50: 4.3nM |
ERK5 | IC50: 810nM |
TGFβR1 | IC50: 1.8μM |
MEK1 | IC50: >6.3μM |
MEK2 | IC50: >6.3μM |
ERK1 | IC50: >6.3μM |
JNK2 | IC50: >6.3μM |
EGFR | IC50: >6.3μM |
STK16 | IC50: >6.3μM |
In vitro (25°C) | DMSO | 43 mg/mL (104.24 mM) | |
Water | <1 mg/mL (<1 mM) | ||
Ethanol | 3 mg/mL (7.27 mM) | ||
In vivo | 30% PEG400/0.5% Tween80/5% propylene glycol | 30 mg/mL | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 23.45 mL | 117.23 mL | 234.47 mL |
0.5 mM | 4.69 mL | 23.45 mL | 46.89 mL |
1 mM | 2.34 mL | 11.72 mL | 23.45 mL |
5 mM | 0.47 mL | 2.34 mL | 4.69 mL |
*The above data is based on the productmolecular weight 426.5 . Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.