Imiquimod (Aldara)
Catalog No. A10469
Imiquimod (Aldara) is a a heterocyclic imidazoquinoline amide that acts as an immune response modifier.
Catalog Num | A10469 |
---|---|
M. Wt | 240.3 |
Formula | C14H16N4 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 99011-02-6 |
Synonyms | Aldara |
SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
Imiquimod (Aldara) is a a heterocyclic imidazoquinoline amide that acts as an immune response modifier.
Targets
In vitro | DMSO | 0.01 mg/mL (<1 mM) | |
Water | <1 mg/mL (<1 mM) | ||
Ethanol | <1 mg/mL (<1 mM) | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 41.61 mL | 208.07 mL | 416.15 mL |
0.5 mM | 8.32 mL | 41.61 mL | 83.23 mL |
1 mM | 4.16 mL | 20.81 mL | 41.61 mL |
5 mM | 0.83 mL | 4.16 mL | 8.32 mL |
*The above data is based on the productmolecular weight 240.3 . Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.