Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Desmopressin(DDAVP) acetate is the synthetic analogue of the antidiuretic hormone arginine vasopressin. |
|---|
| Catalog Num | A15065 |
|---|---|
| Formula | C48H68N14O14S2 |
| Molecular Weight | 1129.27 |
| CAS Number | 62288-83-9 |
| SMILES | CC(=O)O.C1CC(N(C1)C(=O)C2CSSCCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2)CC(=O)N)CCC(=O)N)CC3=CC=CC=C3)CC4=CC=C(C=C4)O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N |
| Synonyms | DDAVP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (83.24 mM) | |
| Water | 94 mg/mL (83.24 mM) | ||
| Ethanol | 94 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.86 mL | 44.28 mL | 88.55 mL |
| 0.5 mM | 1.77 mL | 8.86 mL | 17.71 mL |
| 1 mM | 0.89 mL | 4.43 mL | 8.86 mL |
| 5 mM | 0.18 mL | 0.89 mL | 1.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
