Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK461364 is an ATP-competitive inhibitor of polo-like kinase 1 (Plk1). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10442 |
|---|---|
| Formula | C27H28F3N5O2S |
| Molecular Weight | 543.6 |
| CAS Number | 929095-18-1 |
| SMILES | C[C@H](C1=CC=CC=C1C(F)(F)F)OC2=C(SC(=C2)N3C=NC4=C3C=C(C=C4)CN5CCN(CC5)C)C(=O)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 9 mg/mL (16.55 mM) | |
| Water | Insoluble | ||
| Ethanol | 27 mg/mL (49.66 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.4 mL | 91.98 mL | 183.96 mL |
| 0.5 mM | 3.68 mL | 18.4 mL | 36.79 mL |
| 1 mM | 1.84 mL | 9.2 mL | 18.4 mL |
| 5 mM | 0.37 mL | 1.84 mL | 3.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
