Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML365 is a novel selective small molecule inhibitor of TASK1(KCNK3) with IC50 of 4 nM(thallium influx fluorescent assay) and 16 nM(automated electrophysiology assay). |
|---|
| Catalog Num | A21736 |
|---|---|
| Formula | C22H20N2O3 |
| Molecular Weight | 360.41 |
| CAS Number | 947914-18-3 |
| SMILES | O=C(C1=C(OC)C=CC=C1)NC2=CC=CC(NC(C3=CC=CC(C)=C3)=O)=C2 |
| Synonyms | ML 365, M-365 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (183.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 16 mg/mL (44.39 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.75 mL | 138.73 mL | 277.46 mL |
| 0.5 mM | 5.55 mL | 27.75 mL | 55.49 mL |
| 1 mM | 2.77 mL | 13.87 mL | 27.75 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
