Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Moxisylyte hydrochloride is an alpha-adrenergic blocking agent that is used in Raynaud's disease. It is also used locally in the eye to reverse the mydriasis caused by phenylephrine and other sympathomimetic agents. |
|---|
| Catalog Num | A17725 |
|---|---|
| Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 |
| CAS Number | 964-52-3 |
| SMILES | c1(c(cc(C)c(c1)OC(C)=O)OCC[NH+](C)C)C(C)C.[ClH-] |
| Synonyms | Arlitene, Carlytene, Enfrental, Limatene, M-101, Moxilite, Enfrental Limatene M-101 Moxilite Moxisylyte HCl, Moxisylyte hydrochloride, Opilon |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (196.29 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.66 mL | 158.31 mL | 316.62 mL |
| 0.5 mM | 6.33 mL | 31.66 mL | 63.32 mL |
| 1 mM | 3.17 mL | 15.83 mL | 31.66 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
