Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ozenoxacin is an experimental quinolone antibiotic being developed for the treatment of impetigo and other dermatological bacterial infections. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12996 |
|---|---|
| Formula | C21H21N3O3 |
| Molecular Weight | 363.41 |
| CAS Number | 245765-41-7 |
| SMILES | O=C(C1=CN(C2CC2)C3=C(C=CC(C4=CC(C)=C(NC)N=C4)=C3C)C1=O)O |
| Synonyms | GF-001001-00, M-5120, T-3912, GF-00100100 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (11 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.52 mL | 137.59 mL | 275.17 mL |
| 0.5 mM | 5.5 mL | 27.52 mL | 55.03 mL |
| 1 mM | 2.75 mL | 13.76 mL | 27.52 mL |
| 5 mM | 0.55 mL | 2.75 mL | 5.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
