Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ATN-161 is a novel integrin α5β1 antagonist, which inhibits angiogenesis and growth of liver metastases in a murine model. |
|---|
| Catalog Num | A21307 |
|---|---|
| Formula | C23H35N9O8S |
| Molecular Weight | 597.64 |
| CAS Number | 262438-43-7 |
| SMILES | O=C(N)C[C@@H](C(N)=O)NC([C@H](CS)NC([C@H](CO)NC([C@H](CC1=CNC=N1)NC([C@H]2N(C(C)=O)CCC2)=O)=O)=O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 11 mg/mL (18.4 mM) | |
| Water | 11 mg/mL (18.4 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.73 mL | 83.66 mL | 167.32 mL |
| 0.5 mM | 3.35 mL | 16.73 mL | 33.46 mL |
| 1 mM | 1.67 mL | 8.37 mL | 16.73 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
