Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD4573 is a potent and selective inhibitor of CDK9, with fast-off binding kinetics and high selectivity versus other kinases, including other CDK family kinases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18321 |
|---|---|
| Formula | C22H28ClN5O2 |
| Molecular Weight | 429.94 |
| CAS Number | 2057509-72-3 |
| SMILES | ClC1=CN=C(NC([C@H]2CCC[C@@H](NC(C)=O)C2)=O)C=C1C3=C(CC(C)(C)C4)N4N=C3 |
| Synonyms | AZD 4573, AZD-4573 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (193.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 83 mg/mL (193.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.26 mL | 116.3 mL | 232.59 mL |
| 0.5 mM | 4.65 mL | 23.26 mL | 46.52 mL |
| 1 mM | 2.33 mL | 11.63 mL | 23.26 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
