Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Alpha-Naphthoflavone is a synthetic flavonoid, acts as a potent and competitive aromatase inhibitor with an IC50 and a Ki of 0.5 and 0.2 μM, respectively. |
|---|
| Catalog Num | A18474 |
|---|---|
| Formula | C19H12O2 |
| Molecular Weight | 272.3 |
| CAS Number | 604-59-1 |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=C1C=CC4=CC=CC=C43 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 29 mg/mL (106.5 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.72 mL | 183.62 mL | 367.24 mL |
| 0.5 mM | 7.34 mL | 36.72 mL | 73.45 mL |
| 1 mM | 3.67 mL | 18.36 mL | 36.72 mL |
| 5 mM | 0.73 mL | 3.67 mL | 7.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
