Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ARS-853 is a cell-active, selective, covalent KRAS G12C inhibitor with an IC50 of 2.5 μM. ARS-853 inhibits mutant KRAS-driven signaling by binding to the GDP-bound oncoprotein and preventing activation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12542 |
|---|---|
| Formula | C22H29ClN4O3 |
| Molecular Weight | 432.94 |
| CAS Number | 1629268-00-3 |
| SMILES | ClC1=C(C2(C)CC2)C=C(NCC(N3CCN(C4CN(C(C=C)=O)C4)CC3)=O)C(O)=C1 |
| Synonyms | ARS853, ARS 853 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 80 mg/mL (184.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 1 mg/mL (2.3 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.1 mL | 115.49 mL | 230.98 mL |
| 0.5 mM | 4.62 mL | 23.1 mL | 46.2 mL |
| 1 mM | 2.31 mL | 11.55 mL | 23.1 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
