Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | B-Raf IN 1 is a potent and selective B-Raf kinase inhibitor with an IC50 of 24 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21055 |
|---|---|
| Formula | C29H24F3N5O |
| Molecular Weight | 515.53 |
| CAS Number | 950736-05-7 |
| SMILES | O=C(NC1=CC=CC(C2=CC=NC3=C(C4=CC=C(CN(C)C)C=C4)C=NN23)=C1)C5=CC=CC(C(F)(F)F)=C5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (178.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (9.69 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.4 mL | 96.99 mL | 193.98 mL |
| 0.5 mM | 3.88 mL | 19.4 mL | 38.8 mL |
| 1 mM | 1.94 mL | 9.7 mL | 19.4 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
