Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY 1217389 is a potent, and selective inhibitor of the monopolar spindle 1 (MPS1) kinase with an IC50 value less than 10 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21595 |
|---|---|
| Formula | C27H24F5N5O3 |
| Molecular Weight | 561.5 |
| CAS Number | 1554458-53-5 |
| SMILES | O=C(NC1CC1)C2=CC=C(C3=CN=C4C(NCCC(F)(F)F)=CC(OC5=CC=C(OC)C(F)=C5F)=NN43)C=C2C |
| Synonyms | BAY 1217389, BAY-1217389 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (163.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL (5.34 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.81 mL | 89.05 mL | 178.09 mL |
| 0.5 mM | 3.56 mL | 17.81 mL | 35.62 mL |
| 1 mM | 1.78 mL | 8.9 mL | 17.81 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
