Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Beclometasone dipropionate is a potent glucocorticoid agonist; it is a prodrug of the free form, beclometasone. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17254 |
|---|---|
| Formula | C28H37ClO7 |
| Molecular Weight | 521.04 |
| CAS Number | CAS: 5534-09-8 |
| SMILES | C[C@@]12[C@](C[C@H](C)[C@]2(OC(CC)=O)C(COC(CC)=O)=O)([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C1)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 101 mg/mL (193.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (32.62 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.19 mL | 95.96 mL | 191.92 mL |
| 0.5 mM | 3.84 mL | 19.19 mL | 38.38 mL |
| 1 mM | 1.92 mL | 9.6 mL | 19.19 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
