Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BI-409306 is a potent and selective PDE9A inhibitor, with an IC50 of 52 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12970 |
|---|---|
| Formula | C16H17N5O2 |
| Molecular Weight | 311.34 |
| CAS Number | 1189767-28-9 |
| SMILES | O=C1C2=C(N(C3CCOCC3)N=C2)NC(CC4=CC=CC=N4)=N1 |
| Synonyms | BI409306, BI 409306 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (192.71 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 4 mg/mL (12.84 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.12 mL | 160.6 mL | 321.19 mL |
| 0.5 mM | 6.42 mL | 32.12 mL | 64.24 mL |
| 1 mM | 3.21 mL | 16.06 mL | 32.12 mL |
| 5 mM | 0.64 mL | 3.21 mL | 6.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
