Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cambinol is a SIRT1 and SIRT2 inhibitor with IC50 values of 56 and 59 μM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12381 |
|---|---|
| Formula | C21H16N2O2S |
| Molecular Weight | 360.43 |
| CAS Number | 14513-15-6 |
| SMILES | O=C(C(CC1=C2C=CC=CC2=CC=C1O)=C(C3=CC=CC=C3)N4)NC4=S |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (52.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.74 mL | 138.72 mL | 277.45 mL |
| 0.5 mM | 5.55 mL | 27.74 mL | 55.49 mL |
| 1 mM | 2.77 mL | 13.87 mL | 27.74 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
