Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CGS 21680 is a selective adenosine A2A receptor agonist, with a Ki of 27 nM. |
|---|
| Catalog Num | A11354 |
|---|---|
| Formula | C23H29N7O6 |
| Molecular Weight | 499.52 |
| CAS Number | 120225-54-9 |
| SMILES | O=C(CCC1=CC=C(C=C1)CCNC2=NC3=C(C(N)=N2)N=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)C(NCC)=O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 95 mg/mL (177.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.02 mL | 100.1 mL | 200.19 mL |
| 0.5 mM | 4 mL | 20.02 mL | 40.04 mL |
| 1 mM | 2 mL | 10.01 mL | 20.02 mL |
| 5 mM | 0.4 mL | 2 mL | 4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
