Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | D-Glucose-6-phosphate disodium salt is a glucose sugar phosphorylated at the hydroxy group on carbon 6. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18553 |
|---|---|
| Formula | C6H11Na2O9P |
| Molecular Weight | 304.1 |
| CAS Number | 3671-99-6 |
| SMILES | O=C[C@@H]([C@H]([C@@H]([C@@H](COP(O)(O)=O)O)O)O[Na])O[Na] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 57 mg/mL (187.44 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.88 mL | 164.42 mL | 328.84 mL |
| 0.5 mM | 6.58 mL | 32.88 mL | 65.77 mL |
| 1 mM | 3.29 mL | 16.44 mL | 32.88 mL |
| 5 mM | 0.66 mL | 3.29 mL | 6.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
