Signaling Pathway
FASN inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Desoxyrhaponticin is a stilbene glycoside from the Tibetan nutritional food Rheum tanguticum Maxim. Desoxyrhaponticin is a Fatty acid synthase (FAS) inhibitor, and has apoptotic effect on human cancer cells. |
|---|
| Catalog Num | A20832 |
|---|---|
| Formula | C21H24O8 |
| Molecular Weight | 404.41 |
| CAS Number | 30197-14-9 |
| SMILES | COC(C=C1)=CC=C1/C=C/C2=CC(O)=CC(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO)=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (215.12 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.73 mL | 123.64 mL | 247.27 mL |
| 0.5 mM | 4.95 mL | 24.73 mL | 49.45 mL |
| 1 mM | 2.47 mL | 12.36 mL | 24.73 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
