Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diethylcarbamazine citrate is an inhibitor of arachidonic acid metabolism in filarial microfilaria; is highly specific for several parasites and does not contain any toxic metallic elements. |
|---|
| Catalog Num | A16506 |
|---|---|
| Formula | C16H29N3O8 |
| Molecular Weight | 391.42 |
| CAS Number | 1642-54-2 |
| SMILES | O=C(N1CCN(C)CC1)N(CC)CC.O=C(CC(C(O)=O)(O)CC(O)=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (173.72 mM) | |
| Water | 68 mg/mL (173.72 mM) | ||
| Ethanol | 26 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.55 mL | 127.74 mL | 255.48 mL |
| 0.5 mM | 5.11 mL | 25.55 mL | 51.1 mL |
| 1 mM | 2.55 mL | 12.77 mL | 25.55 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
