Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dimethylenastron is an inhibitor of mitotic motor kinesin Eg5 with IC50 value of 200 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15841 |
|---|---|
| Formula | C16H18N2O2S |
| Molecular Weight | 302.39 |
| CAS Number | 863774-58-7 |
| SMILES | CC1(CC2=C(C(NC(=S)N2)C3=CC(=CC=C3)O)C(=O)C1)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (185.18 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (3.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.07 mL | 165.35 mL | 330.7 mL |
| 0.5 mM | 6.61 mL | 33.07 mL | 66.14 mL |
| 1 mM | 3.31 mL | 16.53 mL | 33.07 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
