Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dinoprost Tromethamine, also known as Dinoprost Trometamol, is a naturally occurring prostaglandin used in medicine to induce labor and as an abortifacient. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17505 |
|---|---|
| Formula | C24H45NO8 |
| Molecular Weight | 475.61 |
| CAS Number | 38562-01-5 |
| SMILES | O=C(O)CCC/C=C/C[C@@H]1[C@@H](/C=C\[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O.OCC(CO)(N)CO |
| Synonyms | U 14585; U14585; U-14585; Dinoprost Tromethamine; Dinoprost Trometamol; Zinoprost; Prostamate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (187.12 mM) | |
| Water | 89 mg/mL (187.12 mM) | ||
| Ethanol | 89 mg/mL (187.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.03 mL | 105.13 mL | 210.26 mL |
| 0.5 mM | 4.21 mL | 21.03 mL | 42.05 mL |
| 1 mM | 2.1 mL | 10.51 mL | 21.03 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
