Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dolasetron mesylate is a selective 5-HT3 receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17729 |
|---|---|
| Formula | C20H24N2O6S |
| Molecular Weight | 420.48 |
| CAS Number | 115956-13-3 |
| SMILES | OS(=O)(C)=O.O=C(C1=CNC2=C1C=CC=C2)O[C@H]3CC(CC4C(C5)=O)N5C(C4)C3 |
| Synonyms | Dolasetron mesylate; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (192.64 mM) | |
| Water | 27 mg/mL (64.21 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.78 mL | 118.91 mL | 237.82 mL |
| 0.5 mM | 4.76 mL | 23.78 mL | 47.56 mL |
| 1 mM | 2.38 mL | 11.89 mL | 23.78 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
