Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ENMD-2076 Tartrate is a multi-targeted kinase inhibitor with IC50s of 1.86, 14, 58.2, 15.9, 92.7, 70.8, 56.4 nM for Aurora A, Flt3, KDR/VEGFR2, Flt4/VEGFR3, FGFR1, FGFR2, Src, PDGFRα, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21583 |
|---|---|
| Formula | C25H31N7O6 |
| Molecular Weight | 525.56 |
| CAS Number | 1291074-87-7 |
| SMILES | O[C@H](C(O)=O)[C@@H](C(O)=O)O.CC1=CC(NC2=NC(/C=C/C3=CC=CC=C3)=NC(N4CCN(CC4)C)=C2)=NN1 |
| Synonyms | ENMD2076, ENMD 2076 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 86 mg/mL (163.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.03 mL | 95.14 mL | 190.27 mL |
| 0.5 mM | 3.81 mL | 19.03 mL | 38.05 mL |
| 1 mM | 1.9 mL | 9.51 mL | 19.03 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
