Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Entacapone is a specific, potent, peripherally acting catechol-O-methyltransferase (COMT) inhibitor with IC50 of 151 nM for PD treatment. |
|---|
| Catalog Num | A10355 |
|---|---|
| Formula | C14H15N3O5 |
| Molecular Weight | 305.29 |
| CAS Number | 130929-57-6 |
| SMILES | O=C(N(CC)CC)/C(C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (176.88 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.76 mL | 163.78 mL | 327.56 mL |
| 0.5 mM | 6.55 mL | 32.76 mL | 65.51 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.76 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
