Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Epertinib hydrochloride is a potent, orally active, reversible, and selective tyrosine kinase inhibitor of EGFR, HER2 and HER4, with IC50s of 1.48 nM, 7.15 nM and 2.49 nM, respectively. Epertinib shows potent antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21950 |
|---|---|
| Formula | C30H28Cl2FN5O3 |
| Molecular Weight | 596.48 |
| CAS Number | 2071195-74-7 |
| SMILES | CC#C/C(C1=CC2=C(NC3=CC=C(OCC4=CC=CC(F)=C4)C(Cl)=C3)N=CN=C2C=C1)=N\OC[C@@H]5NCCOC5.Cl |
| Synonyms | S-22611 hydrochloride, S22611, S 22611 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (147.53 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.77 mL | 83.83 mL | 167.65 mL |
| 0.5 mM | 3.35 mL | 16.77 mL | 33.53 mL |
| 1 mM | 1.68 mL | 8.38 mL | 16.77 mL |
| 5 mM | 0.34 mL | 1.68 mL | 3.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
