Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK467 is a potent and selective inhibitor of KDM5 (also known as JARID1) with a Ki of 10 nM, shows 180-fold selectivity for KDM4C and no measurable inhibitory effects toward KDM6 or other Jumonji family members. GSK467 exploits unique binding modes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18807 |
|---|---|
| Formula | C17H13N5O2 |
| Molecular Weight | 319.32 |
| CAS Number | 1628332-52-4 |
| SMILES | O=C1C2=C(C=NC=C2)N=C(OC3=CN(CC4=CC=CC=C4)N=C3)N1 |
| Synonyms | GSK467; GSK-467; GSK 467; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (21.92 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.32 mL | 156.58 mL | 313.17 mL |
| 0.5 mM | 6.26 mL | 31.32 mL | 62.63 mL |
| 1 mM | 3.13 mL | 15.66 mL | 31.32 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
